C8H8F7NO2 — CID 58057340
2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-prop-2-enylacetamide (PubChem CID 58057340) has the molecular formula C8H8F7NO2 and a molecular weight of 283.14 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-prop-2-enylacetamide.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 58057340 |
| Molecular Formula | C8H8F7NO2 |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)COC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F7NO2/c1-2-3-16-5(17)4-18-8(14,15)6(9,10)7(11,12)13/h2H,1,3-4H2,(H,16,17) |
| InChIKey | JICXRPKQCYGQLB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|