C8H9F7O2 — CID 58057352
1,1,1,2,2,3,3-heptafluoro-3-(2-prop-2-enoxyethoxy)propane (PubChem CID 58057352) has the molecular formula C8H9F7O2 and a molecular weight of 270.14 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-(2-prop-2-enoxyethoxy)propane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-(2-prop-2-enoxyethoxy)propane |
|---|---|
| PubChem CID | 58057352 |
| Molecular Formula | C8H9F7O2 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-(2-prop-2-enoxyethoxy)propane |
| SMILES | C=CCOCCOC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F7O2/c1-2-3-16-4-5-17-8(14,15)6(9,10)7(11,12)13/h2H,1,3-5H2 |
| InChIKey | GSCWCURAYAEBRV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|