About (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol
(2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol (PubChem CID 58058022) has the molecular formula C9H8F3N3O
and a molecular weight of 231.18 g/mol. Its IUPAC name is (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol |
| PubChem CID | 58058022 |
| Molecular Formula | C9H8F3N3O |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol |
| SMILES | [N-]=[N+]=NC[C@@H](O)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H8F3N3O/c10-7-3-9(12)8(11)2-5(7)1-6(16)4-14-15-13/h2-3,6,16H,1,4H2/t6-/m0/s1 |
| InChIKey | HHMADUNKNVWYFC-LURJTMIESA-N |
| XLogP | 2.32 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol?
The IUPAC name of (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol (CID 58058022) is (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol.
What is the SMILES notation for (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol?
The canonical SMILES for (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol is [N-]=[N+]=NC[C@@H](O)Cc1cc(F)c(F)cc1F.
What is the InChIKey of (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol?
The InChIKey is HHMADUNKNVWYFC-LURJTMIESA-N. The full InChI is InChI=1S/C9H8F3N3O/c10-7-3-9(12)8(11)2-5(7)1-6(16)4-14-15-13/h2-3,6,16H,1,4H2/t6-/m0/s1.
What are the key properties of (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol?
(2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol has a molecular weight of 231.18 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-azido-3-(2,4,5-trifluorophenyl)propan-2-ol is sourced from PubChem (CID 58058022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).