C36H33N3O6PS2+ — CID 58058145
2-[2-[(E)-[3-methyl-5-nitro-1-(2-phenoxyethyl)-3-(thiophen-3-ylmethyl)indol-2-ylidene]methyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]ethylphosphonic acid (PubChem CID 58058145) has the molecular formula C36H33N3O6PS2+ and a molecular weight of 698.78 g/mol. Its IUPAC name is 2-[2-[(E)-[3-methyl-5-nitro-1-(2-phenoxyethyl)-3-(thiophen-3-ylmethyl)indol-2-ylidene]methyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]ethylphosphonic acid.
| Compound Name | 2-[2-[(E)-[3-methyl-5-nitro-1-(2-phenoxyethyl)-3-(thiophen-3-ylmethyl)indol-2-ylidene]methyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 58058145 |
| Molecular Formula | C36H33N3O6PS2+ |
| Molecular Weight | 698.78 g/mol |
| Exact Mass | 698.15 |
| IUPAC Name | 2-[2-[(E)-[3-methyl-5-nitro-1-(2-phenoxyethyl)-3-(thiophen-3-ylmethyl)indol-2-ylidene]methyl]benzo[g][1,3]benzothiazol-3-ium-3-yl]ethylphosphonic acid |
| SMILES | CC1(Cc2ccsc2)/C(=C\c2sc3c4ccccc4ccc3[n+]2CCP(=O)(O)O)N(CCOc2ccccc2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C36H32N3O6PS2/c1-36(23-25-15-20-47-24-25)30-21-27(39(40)41)12-14-31(30)37(16-18-45-28-8-3-2-4-9-28)33(36)22-34-38(17-19-46(42,43)44)32-13-11-26-7-5-6-10-29(26)35(32)48-34/h2-15,20-22,24H,16-19,23H2,1H3,(H-,42,43,44)/p+1 |
| InChIKey | MFCSJCYXDLEHEN-UHFFFAOYSA-O |
| XLogP | 7.93 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.78 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|