C36H42 — CID 58058339
1,3,5-tris(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2,4,6-trideuteriobenzene (PubChem CID 58058339) has the molecular formula C36H42 and a molecular weight of 489.82 g/mol. Its IUPAC name is 1,3,5-tris(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2,4,6-trideuteriobenzene.
| Compound Name | 1,3,5-tris(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2,4,6-trideuteriobenzene |
|---|---|
| PubChem CID | 58058339 |
| Molecular Formula | C36H42 |
| Molecular Weight | 489.82 g/mol |
| Exact Mass | 489.42 |
| IUPAC Name | 1,3,5-tris(4-tert-butyl-2,3,5,6-tetradeuteriophenyl)-2,4,6-trideuteriobenzene |
| SMILES | [2H]c1c([2H])c(C(C)(C)C)c([2H])c([2H])c1-c1c([2H])c(-c2c([2H])c([2H])c(C(C)(C)C)c([2H])c2[2H])c([2H])c(-c2c([2H])c([2H])c(C(C)(C)C)c([2H])c2[2H])c1[2H] |
| InChI | InChI=1S/C36H42/c1-34(2,3)31-16-10-25(11-17-31)28-22-29(26-12-18-32(19-13-26)35(4,5)6)24-30(23-28)27-14-20-33(21-15-27)36(7,8)9/h10-24H,1-9H3/i10D,11D,12D,13D,14D,15D,16D,17D,18D,19D,20D,21D,22D,23D,24D |
| InChIKey | RODGPHCVVIYSDD-JEUNIZAVSA-N |
| XLogP | 10.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.82 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |