About 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione
1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 58058410) has the molecular formula C19H13Cl2FN2O3
and a molecular weight of 407.23 g/mol. Its IUPAC name is 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione |
| PubChem CID | 58058410 |
| Molecular Formula | C19H13Cl2FN2O3 |
| Molecular Weight | 407.23 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=C(Cc1ccccc1Cc1c(Cl)cccc1Cl)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H13Cl2FN2O3/c20-14-6-3-7-15(21)13(14)8-11-4-1-2-5-12(11)9-17(25)24-10-16(22)18(26)23-19(24)27/h1-7,10H,8-9H2,(H,23,26,27) |
| InChIKey | HCPJITIPEQIJBY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione?
The IUPAC name of 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione (CID 58058410) is 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione.
What is the SMILES notation for 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione?
The canonical SMILES for 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione is O=C(Cc1ccccc1Cc1c(Cl)cccc1Cl)n1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione?
The InChIKey is HCPJITIPEQIJBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2FN2O3/c20-14-6-3-7-15(21)13(14)8-11-4-1-2-5-12(11)9-17(25)24-10-16(22)18(26)23-19(24)27/h1-7,10H,8-9H2,(H,23,26,27).
What are the key properties of 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione?
1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione has a molecular weight of 407.23 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-[(2,6-dichlorophenyl)methyl]phenyl]acetyl]-5-fluoropyrimidine-2,4-dione is sourced from PubChem (CID 58058410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).