About 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+)
1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+) (PubChem CID 58058726) has the molecular formula C14H17F2ORb
and a molecular weight of 324.75 g/mol. Its IUPAC name is 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+).
Molecular Properties
| Compound Name | 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+) |
| PubChem CID | 58058726 |
| Molecular Formula | C14H17F2ORb |
| Molecular Weight | 324.75 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+) |
| SMILES | CC1CCC(COc2cc[c-]c(F)c2F)CC1.[Rb+] |
| InChI | InChI=1S/C14H17F2O.Rb/c1-10-5-7-11(8-6-10)9-17-13-4-2-3-12(15)14(13)16;/h2,4,10-11H,5-9H2,1H3;/q-1;+1 |
| InChIKey | OACXPVBOLMKVPR-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.75 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+)?
The IUPAC name of 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+) (CID 58058726) is 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+).
What is the SMILES notation for 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+)?
The canonical SMILES for 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+) is CC1CCC(COc2cc[c-]c(F)c2F)CC1.[Rb+].
What is the InChIKey of 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+)?
The InChIKey is OACXPVBOLMKVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2O.Rb/c1-10-5-7-11(8-6-10)9-17-13-4-2-3-12(15)14(13)16;/h2,4,10-11H,5-9H2,1H3;/q-1;+1.
What are the key properties of 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+)?
1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+) has a molecular weight of 324.75 g/mol, XLogP of 0.97, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-3-[(4-methylcyclohexyl)methoxy]benzene-6-ide;rubidium(1+) is sourced from PubChem (CID 58058726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).