C71H60N6O3 — CID 58059049
2-[4-[4-[1,1-bis[4-[4-[1-(2,4-dimethylphenyl)imidazol-2-yl]phenoxy]phenyl]ethyl]phenoxy]phenyl]-1-(2,4-dimethylphenyl)imidazole (PubChem CID 58059049) has the molecular formula C71H60N6O3 and a molecular weight of 1045.30 g/mol. Its IUPAC name is 2-[4-[4-[1,1-bis[4-[4-[1-(2,4-dimethylphenyl)imidazol-2-yl]phenoxy]phenyl]ethyl]phenoxy]phenyl]-1-(2,4-dimethylphenyl)imidazole.
| Compound Name | 2-[4-[4-[1,1-bis[4-[4-[1-(2,4-dimethylphenyl)imidazol-2-yl]phenoxy]phenyl]ethyl]phenoxy]phenyl]-1-(2,4-dimethylphenyl)imidazole |
|---|---|
| PubChem CID | 58059049 |
| Molecular Formula | C71H60N6O3 |
| Molecular Weight | 1045.30 g/mol |
| Exact Mass | 1044.47 |
| IUPAC Name | 2-[4-[4-[1,1-bis[4-[4-[1-(2,4-dimethylphenyl)imidazol-2-yl]phenoxy]phenyl]ethyl]phenoxy]phenyl]-1-(2,4-dimethylphenyl)imidazole |
| SMILES | Cc1ccc(-n2ccnc2-c2ccc(Oc3ccc(C(C)(c4ccc(Oc5ccc(-c6nccn6-c6ccc(C)cc6C)cc5)cc4)c4ccc(Oc5ccc(-c6nccn6-c6ccc(C)cc6C)cc5)cc4)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C71H60N6O3/c1-47-8-35-65(50(4)44-47)75-41-38-72-68(75)53-11-23-59(24-12-53)78-62-29-17-56(18-30-62)71(7,57-19-31-63(32-20-57)79-60-25-13-54(14-26-60)69-73-39-42-76(69)66-36-9-48(2)45-51(66)5)58-21-33-64(34-22-58)80-61-27-15-55(16-28-61)70-74-40-43-77(70)67-37-10-49(3)46-52(67)6/h8-46H,1-7H3 |
| InChIKey | BJAZDVBPKBLKHY-UHFFFAOYSA-N |
| XLogP | 17.83 |
| TPSA | 81.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.30 |
| LogP ≤ 5 | 17.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|