C25H16N8O — CID 58059097
8-[2,3-dimethyl-1-(1,3,5-triazin-2-yl)dibenzofuran-4-yl]-3,6,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 58059097) has the molecular formula C25H16N8O and a molecular weight of 444.46 g/mol. Its IUPAC name is 8-[2,3-dimethyl-1-(1,3,5-triazin-2-yl)dibenzofuran-4-yl]-3,6,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 8-[2,3-dimethyl-1-(1,3,5-triazin-2-yl)dibenzofuran-4-yl]-3,6,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 58059097 |
| Molecular Formula | C25H16N8O |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 8-[2,3-dimethyl-1-(1,3,5-triazin-2-yl)dibenzofuran-4-yl]-3,6,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | Cc1c(C)c(-c2ncncn2)c2c(oc3ccccc32)c1-n1c2nccnc2c2nccnc21 |
| InChI | InChI=1S/C25H16N8O/c1-13-14(2)21(33-24-19(27-7-9-29-24)20-25(33)30-10-8-28-20)22-18(15-5-3-4-6-16(15)34-22)17(13)23-31-11-26-12-32-23/h3-12H,1-2H3 |
| InChIKey | IXCCWNDGGWKGAW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 108.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |