C92H92IrN7 — CID 58059147
iridium(3+);2,4,6-tris[2-[2-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-4-yl]ethyl]pyridine (PubChem CID 58059147) has the molecular formula C92H92IrN7 and a molecular weight of 1488.01 g/mol. Its IUPAC name is iridium(3+);2,4,6-tris[2-[2-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-4-yl]ethyl]pyridine.
| Compound Name | iridium(3+);2,4,6-tris[2-[2-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-4-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 58059147 |
| Molecular Formula | C92H92IrN7 |
| Molecular Weight | 1488.01 g/mol |
| Exact Mass | 1487.70 |
| IUPAC Name | iridium(3+);2,4,6-tris[2-[2-phenyl-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazol-4-yl]ethyl]pyridine |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1cc(CCc2cc(CCc3cn(-c4c(C(C)C)cc(-c5ccccc5)cc4C(C)C)c(-c4[c-]cccc4)n3)nc(CCc3cn(-c4c(C(C)C)cc(-c5ccccc5)cc4C(C)C)c(-c4[c-]cccc4)n3)c2)nc1-c1[c-]cccc1.[Ir+3] |
| InChI | InChI=1S/C92H92N7.Ir/c1-60(2)81-51-73(67-31-19-13-20-32-67)52-82(61(3)4)87(81)97-57-78(94-90(97)70-37-25-16-26-38-70)44-43-66-49-76(45-47-79-58-98(91(95-79)71-39-27-17-28-40-71)88-83(62(5)6)53-74(54-84(88)63(7)8)68-33-21-14-22-34-68)93-77(50-66)46-48-80-59-99(92(96-80)72-41-29-18-30-42-72)89-85(64(9)10)55-75(56-86(89)65(11)12)69-35-23-15-24-36-69;/h13-37,39,41,49-65H,43-48H2,1-12H3;/q-3;+3 |
| InChIKey | GKKGGRKCYZKTJS-UHFFFAOYSA-N |
| XLogP | 23.13 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 100 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1488.01 |
| LogP ≤ 5 | 23.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|