C63H48N6 — CID 58059165
1-[4-[2-[3,5-bis[2-[4-[5-(2,6-dimethylphenyl)pyrazol-1-yl]phenyl]ethynyl]phenyl]ethynyl]phenyl]-5-(2,6-dimethylphenyl)pyrazole (PubChem CID 58059165) has the molecular formula C63H48N6 and a molecular weight of 889.12 g/mol. Its IUPAC name is 1-[4-[2-[3,5-bis[2-[4-[5-(2,6-dimethylphenyl)pyrazol-1-yl]phenyl]ethynyl]phenyl]ethynyl]phenyl]-5-(2,6-dimethylphenyl)pyrazole.
| Compound Name | 1-[4-[2-[3,5-bis[2-[4-[5-(2,6-dimethylphenyl)pyrazol-1-yl]phenyl]ethynyl]phenyl]ethynyl]phenyl]-5-(2,6-dimethylphenyl)pyrazole |
|---|---|
| PubChem CID | 58059165 |
| Molecular Formula | C63H48N6 |
| Molecular Weight | 889.12 g/mol |
| Exact Mass | 888.39 |
| IUPAC Name | 1-[4-[2-[3,5-bis[2-[4-[5-(2,6-dimethylphenyl)pyrazol-1-yl]phenyl]ethynyl]phenyl]ethynyl]phenyl]-5-(2,6-dimethylphenyl)pyrazole |
| SMILES | Cc1cccc(C)c1-c1ccnn1-c1ccc(C#Cc2cc(C#Cc3ccc(-n4nccc4-c4c(C)cccc4C)cc3)cc(C#Cc3ccc(-n4nccc4-c4c(C)cccc4C)cc3)c2)cc1 |
| InChI | InChI=1S/C63H48N6/c1-43-10-7-11-44(2)61(43)58-34-37-64-67(58)55-28-22-49(23-29-55)16-19-52-40-53(20-17-50-24-30-56(31-25-50)68-59(35-38-65-68)62-45(3)12-8-13-46(62)4)42-54(41-52)21-18-51-26-32-57(33-27-51)69-60(36-39-66-69)63-47(5)14-9-15-48(63)6/h7-15,22-42H,1-6H3 |
| InChIKey | PIQHFIKTXFPSFH-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.12 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|