C25H30N5O8P — CID 58059496
ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 58059496) has the molecular formula C25H30N5O8P and a molecular weight of 559.52 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 58059496 |
| Molecular Formula | C25H30N5O8P |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ccnn23)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H30N5O8P/c1-4-35-23(32)16(2)29-39(34,38-17-8-6-5-7-9-17)36-14-20-22(31)24(3,33)25(15-26,37-20)21-11-10-19-18(27)12-13-28-30(19)21/h5-13,16,20,22,31,33H,4,14,27H2,1-3H3,(H,29,34)/t16-,20+,22+,24+,25-,39?/m0/s1 |
| InChIKey | PXMDGAKTTHBINT-ZIYWKCHUSA-N |
| XLogP | 1.89 |
| TPSA | 190.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|