C24H28N5O8P — CID 58059513
ethyl 2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate (PubChem CID 58059513) has the molecular formula C24H28N5O8P and a molecular weight of 545.49 g/mol. Its IUPAC name is ethyl 2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate.
| Compound Name | ethyl 2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 58059513 |
| Molecular Formula | C24H28N5O8P |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | ethyl 2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]acetate |
| SMILES | CCOC(=O)CNP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ccnn23)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H28N5O8P/c1-3-34-21(30)13-28-38(33,37-16-7-5-4-6-8-16)35-14-19-22(31)23(2,32)24(15-25,36-19)20-10-9-18-17(26)11-12-27-29(18)20/h4-12,19,22,31-32H,3,13-14,26H2,1-2H3,(H,28,33)/t19-,22-,23-,24+,38?/m1/s1 |
| InChIKey | LHJYRKOVYFYXRJ-MRDOBPORSA-N |
| XLogP | 1.50 |
| TPSA | 190.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|