C24H28N5O8P — CID 58059517
methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 58059517) has the molecular formula C24H28N5O8P and a molecular weight of 545.49 g/mol. Its IUPAC name is methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 58059517 |
| Molecular Formula | C24H28N5O8P |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | methyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ccnn23)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H28N5O8P/c1-15(22(31)34-3)28-38(33,37-16-7-5-4-6-8-16)35-13-19-21(30)23(2,32)24(14-25,36-19)20-10-9-18-17(26)11-12-27-29(18)20/h4-12,15,19,21,30,32H,13,26H2,1-3H3,(H,28,33)/t15-,19+,21+,23+,24-,38?/m0/s1 |
| InChIKey | QUPBRXIIKMLZJK-YUQIMGLVSA-N |
| XLogP | 1.50 |
| TPSA | 190.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|