C28H34N5O9P — CID 58059528
[(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-4-hydroxy-2-[[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-4-methyloxolan-3-yl] 2-methylpropanoate (PubChem CID 58059528) has the molecular formula C28H34N5O9P and a molecular weight of 615.58 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-4-hydroxy-2-[[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-4-methyloxolan-3-yl] 2-methylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-4-hydroxy-2-[[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-4-methyloxolan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 58059528 |
| Molecular Formula | C28H34N5O9P |
| Molecular Weight | 615.58 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-4-hydroxy-2-[[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-phenoxyphosphoryl]oxymethyl]-4-methyloxolan-3-yl] 2-methylpropanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ccnn23)[C@](C)(O)[C@@H]1OC(=O)C(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C28H34N5O9P/c1-17(2)25(34)40-24-22(15-39-43(37,32-18(3)26(35)38-5)42-19-9-7-6-8-10-19)41-28(16-29,27(24,4)36)23-12-11-21-20(30)13-14-31-33(21)23/h6-14,17-18,22,24,36H,15,30H2,1-5H3,(H,32,37)/t18-,22+,24+,27+,28-,43?/m0/s1 |
| InChIKey | TVSNDQLCQWFKIV-MOJYSVATSA-N |
| XLogP | 2.71 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|