C25H29FN5O8P — CID 58059538
ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-5-fluoropyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 58059538) has the molecular formula C25H29FN5O8P and a molecular weight of 577.51 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-5-fluoropyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-5-fluoropyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 58059538 |
| Molecular Formula | C25H29FN5O8P |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-amino-5-fluoropyrrolo[1,2-b]pyridazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@](C#N)(c2cc(F)c3c(N)ccnn23)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C25H29FN5O8P/c1-4-36-23(33)15(2)30-40(35,39-16-8-6-5-7-9-16)37-13-19-22(32)24(3,34)25(14-27,38-19)20-12-17(26)21-18(28)10-11-29-31(20)21/h5-12,15,19,22,32,34H,4,13,28H2,1-3H3,(H,30,35)/t15-,19+,22+,24+,25-,40?/m0/s1 |
| InChIKey | WJZBKOPXTLJPKM-OWGYZQGLSA-N |
| XLogP | 2.03 |
| TPSA | 190.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|