C32H52O2 — CID 58059562
2-[(Z)-but-1-enyl]-3,5-dimethyl-6-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 58059562) has the molecular formula C32H52O2 and a molecular weight of 468.77 g/mol. Its IUPAC name is 2-[(Z)-but-1-enyl]-3,5-dimethyl-6-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(Z)-but-1-enyl]-3,5-dimethyl-6-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 58059562 |
| Molecular Formula | C32H52O2 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.40 |
| IUPAC Name | 2-[(Z)-but-1-enyl]-3,5-dimethyl-6-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC/C=C\C1=C(C)C(=O)C(C)=C(C/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C)C1=O |
| InChI | InChI=1S/C32H52O2/c1-9-10-20-29-27(7)31(33)28(8)30(32(29)34)22-21-26(6)19-13-18-25(5)17-12-16-24(4)15-11-14-23(2)3/h10,20-21,23-25H,9,11-19,22H2,1-8H3/b20-10-,26-21+ |
| InChIKey | WAZSJCJRZGQSLO-JEPUGQPXSA-N |
| XLogP | 9.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|