C29H50O8 — CID 58059584
[(3R,4S,6S)-6-[(3R,4R,6R)-2-(acetyloxymethyl)-4,5-dimethyl-6-oct-7-enoxyoxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methyl acetate (PubChem CID 58059584) has the molecular formula C29H50O8 and a molecular weight of 526.71 g/mol. Its IUPAC name is [(3R,4S,6S)-6-[(3R,4R,6R)-2-(acetyloxymethyl)-4,5-dimethyl-6-oct-7-enoxyoxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3R,4S,6S)-6-[(3R,4R,6R)-2-(acetyloxymethyl)-4,5-dimethyl-6-oct-7-enoxyoxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 58059584 |
| Molecular Formula | C29H50O8 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | [(3R,4S,6S)-6-[(3R,4R,6R)-2-(acetyloxymethyl)-4,5-dimethyl-6-oct-7-enoxyoxan-3-yl]oxy-3,4,5-trimethyloxan-2-yl]methyl acetate |
| SMILES | C=CCCCCCCO[C@@H]1OC(COC(C)=O)[C@H](O[C@@H]2OC(COC(C)=O)[C@H](C)[C@H](C)C2C)[C@H](C)C1C |
| InChI | InChI=1S/C29H50O8/c1-9-10-11-12-13-14-15-32-28-22(6)20(4)27(26(36-28)17-34-24(8)31)37-29-21(5)18(2)19(3)25(35-29)16-33-23(7)30/h9,18-22,25-29H,1,10-17H2,2-8H3/t18-,19+,20+,21?,22?,25?,26?,27+,28+,29-/m0/s1 |
| InChIKey | GOUOBJSVOOWWOS-LVPAZYSRSA-N |
| XLogP | 5.28 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|