C15H28O5 — CID 58059609
(3R,4R,6R)-2-(hydroxymethyl)-5-methyl-6-oct-7-enoxyoxane-3,4-diol (PubChem CID 58059609) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is (3R,4R,6R)-2-(hydroxymethyl)-5-methyl-6-oct-7-enoxyoxane-3,4-diol.
| Compound Name | (3R,4R,6R)-2-(hydroxymethyl)-5-methyl-6-oct-7-enoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 58059609 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (3R,4R,6R)-2-(hydroxymethyl)-5-methyl-6-oct-7-enoxyoxane-3,4-diol |
| SMILES | C=CCCCCCCO[C@@H]1OC(CO)[C@H](O)[C@H](O)C1C |
| InChI | InChI=1S/C15H28O5/c1-3-4-5-6-7-8-9-19-15-11(2)13(17)14(18)12(10-16)20-15/h3,11-18H,1,4-10H2,2H3/t11?,12?,13-,14+,15-/m1/s1 |
| InChIKey | SZKDBEWKTJNQKW-IPOFZDNWSA-N |
| XLogP | 1.21 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|