C26H33N5O4Rf2-2 — CID 58059746
2-[[4-(dibutylamino)-6-(2-hydroxy-5-methanidyloxyanilino)-1,3,5-triazin-2-yl]methyl]-4-methanidyloxyphenol;bis(rutherfordium) (PubChem CID 58059746) has the molecular formula C26H33N5O4Rf2-2 and a molecular weight of 1013.58 g/mol. Its IUPAC name is 2-[[4-(dibutylamino)-6-(2-hydroxy-5-methanidyloxyanilino)-1,3,5-triazin-2-yl]methyl]-4-methanidyloxyphenol;bis(rutherfordium).
| Compound Name | 2-[[4-(dibutylamino)-6-(2-hydroxy-5-methanidyloxyanilino)-1,3,5-triazin-2-yl]methyl]-4-methanidyloxyphenol;bis(rutherfordium) |
|---|---|
| PubChem CID | 58059746 |
| Molecular Formula | C26H33N5O4Rf2-2 |
| Molecular Weight | 1013.58 g/mol |
| Exact Mass | 1013.50 |
| IUPAC Name | 2-[[4-(dibutylamino)-6-(2-hydroxy-5-methanidyloxyanilino)-1,3,5-triazin-2-yl]methyl]-4-methanidyloxyphenol;bis(rutherfordium) |
| SMILES | [CH2-]Oc1ccc(O)c(Cc2nc(Nc3cc(O[CH2-])ccc3O)nc(N(CCCC)CCCC)n2)c1.[Rf].[Rf] |
| InChI | InChI=1S/C26H33N5O4.2Rf/c1-5-7-13-31(14-8-6-2)26-29-24(16-18-15-19(34-3)9-11-22(18)32)28-25(30-26)27-21-17-20(35-4)10-12-23(21)33;;/h9-12,15,17,32-33H,3-8,13-14,16H2,1-2H3,(H,27,28,29,30);;/q-2;; |
| InChIKey | CABSIGIPXXQYGW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|