About 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile
3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile (PubChem CID 580599) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile |
| PubChem CID | 580599 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile |
| SMILES | N#CCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C7H7N3O2/c8-4-1-5-10-7(12)3-2-6(11)9-10/h2-3H,1,5H2,(H,9,11) |
| InChIKey | DFBSPCFOHXHVIB-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile?
The IUPAC name of 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile (CID 580599) is 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile.
What is the SMILES notation for 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile?
The canonical SMILES for 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile is N#CCCn1[nH]c(=O)ccc1=O.
What is the InChIKey of 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile?
The InChIKey is DFBSPCFOHXHVIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c8-4-1-5-10-7(12)3-2-6(11)9-10/h2-3H,1,5H2,(H,9,11).
What are the key properties of 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile?
3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile has a molecular weight of 165.15 g/mol, XLogP of -0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,6-dioxo-1H-pyridazin-2-yl)propanenitrile is sourced from PubChem (CID 580599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).