About 5,7-dimethyladamantane-1,3-diol
5,7-dimethyladamantane-1,3-diol (PubChem CID 580605) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 5,7-dimethyladamantane-1,3-diol.
Molecular Properties
| Compound Name | 5,7-dimethyladamantane-1,3-diol |
| PubChem CID | 580605 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 5,7-dimethyladamantane-1,3-diol |
| SMILES | CC12CC3(C)CC(O)(C1)CC(O)(C2)C3 |
| InChI | InChI=1S/C12H20O2/c1-9-3-10(2)6-11(13,4-9)8-12(14,5-9)7-10/h13-14H,3-8H2,1-2H3 |
| InChIKey | XNTKRLBGVHQKEJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dimethyladamantane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyladamantane-1,3-diol?
The IUPAC name of 5,7-dimethyladamantane-1,3-diol (CID 580605) is 5,7-dimethyladamantane-1,3-diol.
What is the SMILES notation for 5,7-dimethyladamantane-1,3-diol?
The canonical SMILES for 5,7-dimethyladamantane-1,3-diol is CC12CC3(C)CC(O)(C1)CC(O)(C2)C3.
What is the InChIKey of 5,7-dimethyladamantane-1,3-diol?
The InChIKey is XNTKRLBGVHQKEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-9-3-10(2)6-11(13,4-9)8-12(14,5-9)7-10/h13-14H,3-8H2,1-2H3.
What are the key properties of 5,7-dimethyladamantane-1,3-diol?
5,7-dimethyladamantane-1,3-diol has a molecular weight of 196.29 g/mol, XLogP of 1.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyladamantane-1,3-diol is sourced from PubChem (CID 580605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).