About 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran
7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran (PubChem CID 58060612) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran.
Molecular Properties
| Compound Name | 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran |
| PubChem CID | 58060612 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran |
| SMILES | CC(C)=C1C=CCC2C=COC12 |
| InChI | InChI=1S/C11H14O/c1-8(2)10-5-3-4-9-6-7-12-11(9)10/h3,5-7,9,11H,4H2,1-2H3 |
| InChIKey | VESUWVHAEKYFMY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran?
The IUPAC name of 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran (CID 58060612) is 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran.
What is the SMILES notation for 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran?
The canonical SMILES for 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran is CC(C)=C1C=CCC2C=COC12.
What is the InChIKey of 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran?
The InChIKey is VESUWVHAEKYFMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-8(2)10-5-3-4-9-6-7-12-11(9)10/h3,5-7,9,11H,4H2,1-2H3.
What are the key properties of 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran?
7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran has a molecular weight of 162.23 g/mol, XLogP of 2.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-ylidene-4,7a-dihydro-3aH-1-benzofuran is sourced from PubChem (CID 58060612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).