C8H15FO2 — CID 58060708
(2S,3R,4S,5S)-4-fluoro-2-methoxy-3,5-dimethyloxane (PubChem CID 58060708) has the molecular formula C8H15FO2 and a molecular weight of 162.20 g/mol. Its IUPAC name is (2S,3R,4S,5S)-4-fluoro-2-methoxy-3,5-dimethyloxane.
| Compound Name | (2S,3R,4S,5S)-4-fluoro-2-methoxy-3,5-dimethyloxane |
|---|---|
| PubChem CID | 58060708 |
| Molecular Formula | C8H15FO2 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | (2S,3R,4S,5S)-4-fluoro-2-methoxy-3,5-dimethyloxane |
| SMILES | CO[C@H]1OC[C@H](C)[C@H](F)[C@@H]1C |
| InChI | InChI=1S/C8H15FO2/c1-5-4-11-8(10-3)6(2)7(5)9/h5-8H,4H2,1-3H3/t5-,6-,7-,8-/m0/s1 |
| InChIKey | QZLFAVZRCJMTTI-XAMCCFCMSA-N |
| XLogP | 1.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |