C19H28O5Si — CID 58060720
(2R,4aR,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one (PubChem CID 58060720) has the molecular formula C19H28O5Si and a molecular weight of 364.51 g/mol. Its IUPAC name is (2R,4aR,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one.
| Compound Name | (2R,4aR,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one |
|---|---|
| PubChem CID | 58060720 |
| Molecular Formula | C19H28O5Si |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2R,4aR,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)CO[C@@H]2CO[C@@H](c3ccccc3)OC12 |
| InChI | InChI=1S/C19H28O5Si/c1-19(2,3)25(4,5)24-16-14(20)11-21-15-12-22-18(23-17(15)16)13-9-7-6-8-10-13/h6-10,15-18H,11-12H2,1-5H3/t15-,16-,17?,18-/m1/s1 |
| InChIKey | IELNPMKDJUOLMG-KTBGXXAUSA-N |
| XLogP | 3.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|