About (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol
(2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol (PubChem CID 58060762) has the molecular formula C8H15FO3
and a molecular weight of 178.20 g/mol. Its IUPAC name is (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol.
Molecular Properties
| Compound Name | (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol |
| PubChem CID | 58060762 |
| Molecular Formula | C8H15FO3 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol |
| SMILES | CC1(C)CO[C@H](CO)C(O)[C@H]1F |
| InChI | InChI=1S/C8H15FO3/c1-8(2)4-12-5(3-10)6(11)7(8)9/h5-7,10-11H,3-4H2,1-2H3/t5-,6?,7-/m1/s1 |
| InChIKey | TZOKLANHDFGPMI-YFBHCESUSA-N |
| XLogP | 0.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol?
The IUPAC name of (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol (CID 58060762) is (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol.
What is the SMILES notation for (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol?
The canonical SMILES for (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol is CC1(C)CO[C@H](CO)C(O)[C@H]1F.
What is the InChIKey of (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol?
The InChIKey is TZOKLANHDFGPMI-YFBHCESUSA-N. The full InChI is InChI=1S/C8H15FO3/c1-8(2)4-12-5(3-10)6(11)7(8)9/h5-7,10-11H,3-4H2,1-2H3/t5-,6?,7-/m1/s1.
What are the key properties of (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol?
(2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol has a molecular weight of 178.20 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-4-fluoro-2-(hydroxymethyl)-5,5-dimethyloxan-3-ol is sourced from PubChem (CID 58060762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).