C11H18F2NO3P — CID 58060793
3-[[(2R,5R)-2-(deuteriomethyl)-4,4-difluoro-5-methyloxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile (PubChem CID 58060793) has the molecular formula C11H18F2NO3P and a molecular weight of 282.25 g/mol. Its IUPAC name is 3-[[(2R,5R)-2-(deuteriomethyl)-4,4-difluoro-5-methyloxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,5R)-2-(deuteriomethyl)-4,4-difluoro-5-methyloxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 58060793 |
| Molecular Formula | C11H18F2NO3P |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-[[(2R,5R)-2-(deuteriomethyl)-4,4-difluoro-5-methyloxan-3-yl]oxy-methylphosphanyl]oxypropanenitrile |
| SMILES | [2H]C[C@H]1OC[C@@H](C)C(F)(F)C1OP(C)OCCC#N |
| InChI | InChI=1S/C11H18F2NO3P/c1-8-7-15-9(2)10(11(8,12)13)17-18(3)16-6-4-5-14/h8-10H,4,6-7H2,1-3H3/t8-,9-,10?,18?/m1/s1/i2D |
| InChIKey | SBESDBXBXPKZLX-UTXDFBTLSA-N |
| XLogP | 2.93 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|