C18H23FO5 — CID 58060813
[(2R,4aR,7S,8R)-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate (PubChem CID 58060813) has the molecular formula C18H23FO5 and a molecular weight of 338.38 g/mol. Its IUPAC name is [(2R,4aR,7S,8R)-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,4aR,7S,8R)-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58060813 |
| Molecular Formula | C18H23FO5 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [(2R,4aR,7S,8R)-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1CO[C@@H]2CO[C@@H](c3ccccc3)OC2[C@@H]1F |
| InChI | InChI=1S/C18H23FO5/c1-18(2,3)17(20)23-12-9-21-13-10-22-16(24-15(13)14(12)19)11-7-5-4-6-8-11/h4-8,12-16H,9-10H2,1-3H3/t12-,13+,14+,15?,16+/m0/s1 |
| InChIKey | QLEOGVFOJWVISD-QCFNQLOMSA-N |
| XLogP | 2.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |