C16H16BrF3O4 — CID 58061246
2-[5-bromo-2-(trifluoromethoxy)phenyl]-5,5,7,7-tetramethyl-1,6-dioxaspiro[2.4]heptan-4-one (PubChem CID 58061246) has the molecular formula C16H16BrF3O4 and a molecular weight of 409.20 g/mol. Its IUPAC name is 2-[5-bromo-2-(trifluoromethoxy)phenyl]-5,5,7,7-tetramethyl-1,6-dioxaspiro[2.4]heptan-4-one.
| Compound Name | 2-[5-bromo-2-(trifluoromethoxy)phenyl]-5,5,7,7-tetramethyl-1,6-dioxaspiro[2.4]heptan-4-one |
|---|---|
| PubChem CID | 58061246 |
| Molecular Formula | C16H16BrF3O4 |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 2-[5-bromo-2-(trifluoromethoxy)phenyl]-5,5,7,7-tetramethyl-1,6-dioxaspiro[2.4]heptan-4-one |
| SMILES | CC1(C)OC(C)(C)C2(OC2c2cc(Br)ccc2OC(F)(F)F)C1=O |
| InChI | InChI=1S/C16H16BrF3O4/c1-13(2)12(21)15(14(3,4)24-13)11(23-15)9-7-8(17)5-6-10(9)22-16(18,19)20/h5-7,11H,1-4H3 |
| InChIKey | MMLWMVBMNVMPNC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|