About 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole
5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (PubChem CID 580614) has the molecular formula C6H7NS
and a molecular weight of 125.20 g/mol. Its IUPAC name is 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
Molecular Properties
| Compound Name | 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole |
| PubChem CID | 580614 |
| Molecular Formula | C6H7NS |
| Molecular Weight | 125.20 g/mol |
| Exact Mass | 125.03 |
| IUPAC Name | 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole |
| SMILES | c1nc2c(s1)CCC2 |
| InChI | InChI=1S/C6H7NS/c1-2-5-6(3-1)8-4-7-5/h4H,1-3H2 |
| InChIKey | QCCKBDNIBZPFCH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The IUPAC name of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (CID 580614) is 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
What is the SMILES notation for 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The canonical SMILES for 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is c1nc2c(s1)CCC2.
What is the InChIKey of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The InChIKey is QCCKBDNIBZPFCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NS/c1-2-5-6(3-1)8-4-7-5/h4H,1-3H2.
What are the key properties of 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
5,6-dihydro-4H-cyclopenta[d][1,3]thiazole has a molecular weight of 125.20 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is sourced from PubChem (CID 580614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).