About 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one
4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one (PubChem CID 58061498) has the molecular formula C25H24ClFO3
and a molecular weight of 426.92 g/mol. Its IUPAC name is 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one.
Molecular Properties
| Compound Name | 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one |
| PubChem CID | 58061498 |
| Molecular Formula | C25H24ClFO3 |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one |
| SMILES | CCc1ccc(Oc2ccc(Cl)cc2F)cc1C1=C(O)C2C3CCC(CC3)C2C1=O |
| InChI | InChI=1S/C25H24ClFO3/c1-2-13-7-9-17(30-20-10-8-16(26)11-19(20)27)12-18(13)23-24(28)21-14-3-4-15(6-5-14)22(21)25(23)29/h7-12,14-15,21-22,28H,2-6H2,1H3 |
| InChIKey | SYWTZPHFSGCHEG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one?
The IUPAC name of 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one (CID 58061498) is 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one.
What is the SMILES notation for 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one?
The canonical SMILES for 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one is CCc1ccc(Oc2ccc(Cl)cc2F)cc1C1=C(O)C2C3CCC(CC3)C2C1=O.
What is the InChIKey of 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one?
The InChIKey is SYWTZPHFSGCHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24ClFO3/c1-2-13-7-9-17(30-20-10-8-16(26)11-19(20)27)12-18(13)23-24(28)21-14-3-4-15(6-5-14)22(21)25(23)29/h7-12,14-15,21-22,28H,2-6H2,1H3.
What are the key properties of 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one?
4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one has a molecular weight of 426.92 g/mol, XLogP of 6.74, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-chloro-2-fluorophenoxy)-2-ethylphenyl]-5-hydroxytricyclo[5.2.2.02,6]undec-4-en-3-one is sourced from PubChem (CID 58061498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).