C17H26O7 — CID 58061632
7,16-dimethyl-3,8,12,19,20-pentaoxatricyclo[14.2.1.17,10]icosane-4,13-dione (PubChem CID 58061632) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is 7,16-dimethyl-3,8,12,19,20-pentaoxatricyclo[14.2.1.17,10]icosane-4,13-dione.
| Compound Name | 7,16-dimethyl-3,8,12,19,20-pentaoxatricyclo[14.2.1.17,10]icosane-4,13-dione |
|---|---|
| PubChem CID | 58061632 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 7,16-dimethyl-3,8,12,19,20-pentaoxatricyclo[14.2.1.17,10]icosane-4,13-dione |
| SMILES | CC12CCC(=O)OCC3COC(C)(CCC(=O)OCC(CC1)O2)O3 |
| InChI | InChI=1S/C17H26O7/c1-16-6-3-12(23-16)9-20-15(19)5-8-17(2)22-11-13(24-17)10-21-14(18)4-7-16/h12-13H,3-11H2,1-2H3 |
| InChIKey | NHSCSQUUFJPXKB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |