C15H26O7 — CID 58062028
[(3R,4R,5R,6R)-2-acetyloxy-6-ethyl-4-(2-methoxyethoxy)-5-methyloxan-3-yl] acetate (PubChem CID 58062028) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-2-acetyloxy-6-ethyl-4-(2-methoxyethoxy)-5-methyloxan-3-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-2-acetyloxy-6-ethyl-4-(2-methoxyethoxy)-5-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 58062028 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [(3R,4R,5R,6R)-2-acetyloxy-6-ethyl-4-(2-methoxyethoxy)-5-methyloxan-3-yl] acetate |
| SMILES | CC[C@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@H](OCCOC)[C@@H]1C |
| InChI | InChI=1S/C15H26O7/c1-6-12-9(2)13(19-8-7-18-5)14(20-10(3)16)15(22-12)21-11(4)17/h9,12-15H,6-8H2,1-5H3/t9-,12-,13-,14-,15?/m1/s1 |
| InChIKey | KAYBZELTNZWCFP-GLIQJBRLSA-N |
| XLogP | 1.28 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|