C11H13Cl3 — CID 58062452
1,2,3-trichloro-4-(2,2-dimethylpropyl)benzene (PubChem CID 58062452) has the molecular formula C11H13Cl3 and a molecular weight of 251.58 g/mol. Its IUPAC name is 1,2,3-trichloro-4-(2,2-dimethylpropyl)benzene.
| Compound Name | 1,2,3-trichloro-4-(2,2-dimethylpropyl)benzene |
|---|---|
| PubChem CID | 58062452 |
| Molecular Formula | C11H13Cl3 |
| Molecular Weight | 251.58 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1,2,3-trichloro-4-(2,2-dimethylpropyl)benzene |
| SMILES | CC(C)(C)Cc1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C11H13Cl3/c1-11(2,3)6-7-4-5-8(12)10(14)9(7)13/h4-5H,6H2,1-3H3 |
| InChIKey | FZHRJOPWNOAOBD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|