C18H16N4O — CID 58063717
13-(dimethylamino)-5-phenyl-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 58063717) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 13-(dimethylamino)-5-phenyl-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-(dimethylamino)-5-phenyl-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 58063717 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 13-(dimethylamino)-5-phenyl-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | CN(C)c1ccnc2c1-c1ncn(-c3ccccc3)c(=O)c1C2 |
| InChI | InChI=1S/C18H16N4O/c1-21(2)15-8-9-19-14-10-13-17(16(14)15)20-11-22(18(13)23)12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3 |
| InChIKey | HJIZDKOEPCPZEP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |