About CID 58064056
CID 58064056 (PubChem CID 58064056) has the molecular formula C5H5N2O
and a molecular weight of 109.11 g/mol.
Molecular Properties
| Compound Name | CID 58064056 |
| PubChem CID | 58064056 |
| Molecular Formula | C5H5N2O |
| Molecular Weight | 109.11 g/mol |
| Exact Mass | 109.04 |
| IUPAC Name | — |
| SMILES | Cn1[c]cncc1=O |
| InChI | InChI=1S/C5H5N2O/c1-7-3-2-6-4-5(7)8/h2,4H,1H3 |
| InChIKey | XWOBEIRQCDIHNX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.11 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58064056 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58064056?
The IUPAC name of CID 58064056 (CID 58064056) is not available.
What is the SMILES notation for CID 58064056?
The canonical SMILES for CID 58064056 is Cn1[c]cncc1=O.
What is the InChIKey of CID 58064056?
The InChIKey is XWOBEIRQCDIHNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N2O/c1-7-3-2-6-4-5(7)8/h2,4H,1H3.
What are the key properties of CID 58064056?
CID 58064056 has a molecular weight of 109.11 g/mol, XLogP of -0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58064056 is sourced from PubChem (CID 58064056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).