C29H31N3O4 — CID 58064434
2-[4-[4-[4-[(4-aminophenyl)carbamoyl]-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetic acid (PubChem CID 58064434) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-[4-[4-[4-[(4-aminophenyl)carbamoyl]-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[4-[(4-aminophenyl)carbamoyl]-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 58064434 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 2-[4-[4-[4-[(4-aminophenyl)carbamoyl]-2,3-dihydro-1,4-benzoxazin-7-yl]phenyl]cyclohexyl]acetic acid |
| SMILES | Nc1ccc(NC(=O)N2CCOc3cc(-c4ccc(C5CCC(CC(=O)O)CC5)cc4)ccc32)cc1 |
| InChI | InChI=1S/C29H31N3O4/c30-24-10-12-25(13-11-24)31-29(35)32-15-16-36-27-18-23(9-14-26(27)32)22-7-5-21(6-8-22)20-3-1-19(2-4-20)17-28(33)34/h5-14,18-20H,1-4,15-17,30H2,(H,31,35)(H,33,34) |
| InChIKey | SYASIRNZIXHXAZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|