C29H32N2O — CID 58064565
5-[4-(4-ethylcyclohexyl)phenyl]-N-phenyl-2,3-dihydroindole-1-carboxamide (PubChem CID 58064565) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is 5-[4-(4-ethylcyclohexyl)phenyl]-N-phenyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | 5-[4-(4-ethylcyclohexyl)phenyl]-N-phenyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 58064565 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 5-[4-(4-ethylcyclohexyl)phenyl]-N-phenyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CCC1CCC(c2ccc(-c3ccc4c(c3)CCN4C(=O)Nc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H32N2O/c1-2-21-8-10-22(11-9-21)23-12-14-24(15-13-23)25-16-17-28-26(20-25)18-19-31(28)29(32)30-27-6-4-3-5-7-27/h3-7,12-17,20-22H,2,8-11,18-19H2,1H3,(H,30,32) |
| InChIKey | CZVINVYCGGSIPE-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |