C22H16Cl2FN7 — CID 58065242
6-(2-chloro-6-fluorophenyl)-4-N-(2-chloro-4-pyridinyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 58065242) has the molecular formula C22H16Cl2FN7 and a molecular weight of 468.32 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-4-N-(2-chloro-4-pyridinyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-4-N-(2-chloro-4-pyridinyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58065242 |
| Molecular Formula | C22H16Cl2FN7 |
| Molecular Weight | 468.32 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-4-N-(2-chloro-4-pyridinyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(/C=N/Nc2nc(Nc3ccnc(Cl)c3)nc(-c3c(F)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C22H16Cl2FN7/c1-13-5-7-14(8-6-13)12-27-32-22-30-20(19-16(23)3-2-4-17(19)25)29-21(31-22)28-15-9-10-26-18(24)11-15/h2-12H,1H3,(H2,26,28,29,30,31,32)/b27-12+ |
| InChIKey | OZNUTXIUNJALLL-KKMKTNMSSA-N |
| XLogP | 5.88 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.32 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|