C23H16Cl3FN6 — CID 58065245
6-(2-chloro-6-fluorophenyl)-4-N-(3,4-dichlorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 58065245) has the molecular formula C23H16Cl3FN6 and a molecular weight of 501.78 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-4-N-(3,4-dichlorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-4-N-(3,4-dichlorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58065245 |
| Molecular Formula | C23H16Cl3FN6 |
| Molecular Weight | 501.78 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-4-N-(3,4-dichlorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(/C=N/Nc2nc(Nc3ccc(Cl)c(Cl)c3)nc(-c3c(F)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C23H16Cl3FN6/c1-13-5-7-14(8-6-13)12-28-33-23-31-21(20-17(25)3-2-4-19(20)27)30-22(32-23)29-15-9-10-16(24)18(26)11-15/h2-12H,1H3,(H2,29,30,31,32,33)/b28-12+ |
| InChIKey | DETKMAHUKHQALE-KVSWJAHQSA-N |
| XLogP | 7.14 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.78 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|