C22H22ClFN6O — CID 58065250
6-(2-chloro-6-fluorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-4-N-(oxolan-3-ylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 58065250) has the molecular formula C22H22ClFN6O and a molecular weight of 440.91 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-4-N-(oxolan-3-ylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-4-N-(oxolan-3-ylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58065250 |
| Molecular Formula | C22H22ClFN6O |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-2-N-[(E)-(4-methylphenyl)methylideneamino]-4-N-(oxolan-3-ylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(/C=N/Nc2nc(NCC3CCOC3)nc(-c3c(F)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C22H22ClFN6O/c1-14-5-7-15(8-6-14)12-26-30-22-28-20(19-17(23)3-2-4-18(19)24)27-21(29-22)25-11-16-9-10-31-13-16/h2-8,12,16H,9-11,13H2,1H3,(H2,25,27,28,29,30)/b26-12+ |
| InChIKey | XDLSCDXPIGBNLQ-RPPGKUMJSA-N |
| XLogP | 4.53 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|