C19H19ClFN7 — CID 58065290
4-(2-chloro-6-fluorophenyl)-6-(2,2-dimethylhydrazinyl)-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazin-2-amine (PubChem CID 58065290) has the molecular formula C19H19ClFN7 and a molecular weight of 399.86 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-6-(2,2-dimethylhydrazinyl)-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-6-(2,2-dimethylhydrazinyl)-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58065290 |
| Molecular Formula | C19H19ClFN7 |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-6-(2,2-dimethylhydrazinyl)-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(/C=N/Nc2nc(NN(C)C)nc(-c3c(F)cccc3Cl)n2)cc1 |
| InChI | InChI=1S/C19H19ClFN7/c1-12-7-9-13(10-8-12)11-22-26-18-23-17(24-19(25-18)27-28(2)3)16-14(20)5-4-6-15(16)21/h4-11H,1-3H3,(H2,23,24,25,26,27)/b22-11+ |
| InChIKey | RHRJCBNQOLNTDK-SSDVNMTOSA-N |
| XLogP | 3.97 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|