C18H16ClFN6 — CID 58065300
6-(2-chloro-6-fluorophenyl)-4-N-methyl-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 58065300) has the molecular formula C18H16ClFN6 and a molecular weight of 370.82 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-4-N-methyl-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-4-N-methyl-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58065300 |
| Molecular Formula | C18H16ClFN6 |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-4-N-methyl-2-N-[(E)-(4-methylphenyl)methylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N/N=C/c2ccc(C)cc2)nc(-c2c(F)cccc2Cl)n1 |
| InChI | InChI=1S/C18H16ClFN6/c1-11-6-8-12(9-7-11)10-22-26-18-24-16(23-17(21-2)25-18)15-13(19)4-3-5-14(15)20/h3-10H,1-2H3,(H2,21,23,24,25,26)/b22-10+ |
| InChIKey | ZPPHGJXSSLXVCL-LSHDLFTRSA-N |
| XLogP | 4.13 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|