About N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide
N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide (PubChem CID 58065579) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide.
Molecular Properties
| Compound Name | N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide |
| PubChem CID | 58065579 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide |
| SMILES | CCC=CC=CCC(=O)NC1=CC=CC1 |
| InChI | InChI=1S/C13H17NO/c1-2-3-4-5-6-11-13(15)14-12-9-7-8-10-12/h3-9H,2,10-11H2,1H3,(H,14,15) |
| InChIKey | PZSQUEXSACCYAE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide?
The IUPAC name of N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide (CID 58065579) is N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide.
What is the SMILES notation for N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide?
The canonical SMILES for N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide is CCC=CC=CCC(=O)NC1=CC=CC1.
What is the InChIKey of N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide?
The InChIKey is PZSQUEXSACCYAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-2-3-4-5-6-11-13(15)14-12-9-7-8-10-12/h3-9H,2,10-11H2,1H3,(H,14,15).
What are the key properties of N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide?
N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide has a molecular weight of 203.28 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopenta-1,3-dien-1-ylocta-3,5-dienamide is sourced from PubChem (CID 58065579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).