C21H20BrN3O2 — CID 58065827
8-bromo-5-(2-hydroxy-3-phenoxypropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonitrile (PubChem CID 58065827) has the molecular formula C21H20BrN3O2 and a molecular weight of 426.31 g/mol. Its IUPAC name is 8-bromo-5-(2-hydroxy-3-phenoxypropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonitrile.
| Compound Name | 8-bromo-5-(2-hydroxy-3-phenoxypropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonitrile |
|---|---|
| PubChem CID | 58065827 |
| Molecular Formula | C21H20BrN3O2 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 8-bromo-5-(2-hydroxy-3-phenoxypropyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonitrile |
| SMILES | N#CN1CCc2c(c3cc(Br)ccc3n2CC(O)COc2ccccc2)C1 |
| InChI | InChI=1S/C21H20BrN3O2/c22-15-6-7-20-18(10-15)19-12-24(14-23)9-8-21(19)25(20)11-16(26)13-27-17-4-2-1-3-5-17/h1-7,10,16,26H,8-9,11-13H2 |
| InChIKey | LFSDAHIOIDRPLE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|