About 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol
3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol (PubChem CID 58065861) has the molecular formula C21H16Br2FNO3S
and a molecular weight of 541.24 g/mol. Its IUPAC name is 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol.
Molecular Properties
| Compound Name | 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol |
| PubChem CID | 58065861 |
| Molecular Formula | C21H16Br2FNO3S |
| Molecular Weight | 541.24 g/mol |
| Exact Mass | 538.92 |
| IUPAC Name | 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol |
| SMILES | O=S(=O)(CC(F)Cn1c2ccc(Br)cc2c2cc(Br)ccc21)c1cccc(O)c1 |
| InChI | InChI=1S/C21H16Br2FNO3S/c22-13-4-6-20-18(8-13)19-9-14(23)5-7-21(19)25(20)11-15(24)12-29(27,28)17-3-1-2-16(26)10-17/h1-10,15,26H,11-12H2 |
| InChIKey | XHSJAOMUWBZDGF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.24 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol?
The IUPAC name of 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol (CID 58065861) is 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol.
What is the SMILES notation for 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol?
The canonical SMILES for 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol is O=S(=O)(CC(F)Cn1c2ccc(Br)cc2c2cc(Br)ccc21)c1cccc(O)c1.
What is the InChIKey of 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol?
The InChIKey is XHSJAOMUWBZDGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16Br2FNO3S/c22-13-4-6-20-18(8-13)19-9-14(23)5-7-21(19)25(20)11-15(24)12-29(27,28)17-3-1-2-16(26)10-17/h1-10,15,26H,11-12H2.
What are the key properties of 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol?
3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol has a molecular weight of 541.24 g/mol, XLogP of 5.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3,6-dibromocarbazol-9-yl)-2-fluoropropyl]sulfonylphenol is sourced from PubChem (CID 58065861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).