C24H23F2N5O2 — CID 58065945
1-butyl-3-[2,4-difluoro-3-[hydroxy-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenyl]urea (PubChem CID 58065945) has the molecular formula C24H23F2N5O2 and a molecular weight of 451.48 g/mol. Its IUPAC name is 1-butyl-3-[2,4-difluoro-3-[hydroxy-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenyl]urea.
| Compound Name | 1-butyl-3-[2,4-difluoro-3-[hydroxy-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 58065945 |
| Molecular Formula | C24H23F2N5O2 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 1-butyl-3-[2,4-difluoro-3-[hydroxy-(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl]phenyl]urea |
| SMILES | CCCCNC(=O)Nc1ccc(F)c(C(O)c2c[nH]c3ncc(-c4cccnc4)cc23)c1F |
| InChI | InChI=1S/C24H23F2N5O2/c1-2-3-9-28-24(33)31-19-7-6-18(25)20(21(19)26)22(32)17-13-30-23-16(17)10-15(12-29-23)14-5-4-8-27-11-14/h4-8,10-13,22,32H,2-3,9H2,1H3,(H,29,30)(H2,28,31,33) |
| InChIKey | ZNGPXOIDSBSXSD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|