C27H26N2O5 — CID 58066313
3-[[3-[5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]propanoic acid (PubChem CID 58066313) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 3-[[3-[5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]propanoic acid.
| Compound Name | 3-[[3-[5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 58066313 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 3-[[3-[5-[3-(methoxymethyl)-4-(2-methylphenyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methoxy]propanoic acid |
| SMILES | COCc1cc(-c2nc(-c3cccc(COCCC(=O)O)c3)no2)ccc1-c1ccccc1C |
| InChI | InChI=1S/C27H26N2O5/c1-18-6-3-4-9-23(18)24-11-10-21(15-22(24)17-32-2)27-28-26(29-34-27)20-8-5-7-19(14-20)16-33-13-12-25(30)31/h3-11,14-15H,12-13,16-17H2,1-2H3,(H,30,31) |
| InChIKey | QXPLCFSPVSZSRP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|