About (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile
(2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile (PubChem CID 58066431) has the molecular formula C11H7NO3
and a molecular weight of 201.18 g/mol. Its IUPAC name is (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile.
Molecular Properties
| Compound Name | (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile |
| PubChem CID | 58066431 |
| Molecular Formula | C11H7NO3 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile |
| SMILES | C#C/C(C#N)=C/c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C11H7NO3/c1-2-7(6-12)3-8-4-9(13)11(15)10(14)5-8/h1,3-5,13-15H/b7-3- |
| InChIKey | PNJOQVCERKGZPP-CLTKARDFSA-N |
| XLogP | 1.34 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile?
The IUPAC name of (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile (CID 58066431) is (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile.
What is the SMILES notation for (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile?
The canonical SMILES for (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile is C#C/C(C#N)=C/c1cc(O)c(O)c(O)c1.
What is the InChIKey of (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile?
The InChIKey is PNJOQVCERKGZPP-CLTKARDFSA-N. The full InChI is InChI=1S/C11H7NO3/c1-2-7(6-12)3-8-4-9(13)11(15)10(14)5-8/h1,3-5,13-15H/b7-3-.
What are the key properties of (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile?
(2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile has a molecular weight of 201.18 g/mol, XLogP of 1.34, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(3,4,5-trihydroxyphenyl)methylidene]but-3-ynenitrile is sourced from PubChem (CID 58066431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).