About 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate
2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate (PubChem CID 58066808) has the molecular formula C23H35NO3S2
and a molecular weight of 437.67 g/mol. Its IUPAC name is 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate.
Molecular Properties
| Compound Name | 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate |
| PubChem CID | 58066808 |
| Molecular Formula | C23H35NO3S2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate |
| SMILES | CCN(CCOC(=O)CCCCC1CCSS1)CC(=O)Cc1c(C)cccc1C |
| InChI | InChI=1S/C23H35NO3S2/c1-4-24(17-20(25)16-22-18(2)8-7-9-19(22)3)13-14-27-23(26)11-6-5-10-21-12-15-28-29-21/h7-9,21H,4-6,10-17H2,1-3H3 |
| InChIKey | UERFJLABTOYECN-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate?
The IUPAC name of 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate (CID 58066808) is 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate.
What is the SMILES notation for 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate?
The canonical SMILES for 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate is CCN(CCOC(=O)CCCCC1CCSS1)CC(=O)Cc1c(C)cccc1C.
What is the InChIKey of 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate?
The InChIKey is UERFJLABTOYECN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35NO3S2/c1-4-24(17-20(25)16-22-18(2)8-7-9-19(22)3)13-14-27-23(26)11-6-5-10-21-12-15-28-29-21/h7-9,21H,4-6,10-17H2,1-3H3.
What are the key properties of 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate?
2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate has a molecular weight of 437.67 g/mol, XLogP of 4.99, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(2,6-dimethylphenyl)-2-oxopropyl]-ethylamino]ethyl 5-(dithiolan-3-yl)pentanoate is sourced from PubChem (CID 58066808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).